C17H20O2 — CID 70225108
[(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 2-phenylacetate (PubChem CID 70225108) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 2-phenylacetate.
| Compound Name | [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 2-phenylacetate |
|---|---|
| PubChem CID | 70225108 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 2-phenylacetate |
| SMILES | CC1=CC(C)/C(=C\OC(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H20O2/c1-13-8-9-16(14(2)10-13)12-19-17(18)11-15-6-4-3-5-7-15/h3-7,10,12,14H,8-9,11H2,1-2H3/b16-12- |
| InChIKey | ZBNIVRHFOPMNRP-VBKFSLOCSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|