About [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate
[(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate (PubChem CID 70226149) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate.
Molecular Properties
| Compound Name | [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate |
| PubChem CID | 70226149 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate |
| SMILES | CC1=CC(C)/C(=C\OC(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H22O2/c1-14-8-10-17(15(2)12-14)13-20-18(19)11-9-16-6-4-3-5-7-16/h3-7,12-13,15H,8-11H2,1-2H3/b17-13- |
| InChIKey | FUEPXJJINAEGML-LGMDPLHJSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate?
The IUPAC name of [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate (CID 70226149) is [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate.
What is the SMILES notation for [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate?
The canonical SMILES for [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate is CC1=CC(C)/C(=C\OC(=O)CCc2ccccc2)CC1.
What is the InChIKey of [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate?
The InChIKey is FUEPXJJINAEGML-LGMDPLHJSA-N. The full InChI is InChI=1S/C18H22O2/c1-14-8-10-17(15(2)12-14)13-20-18(19)11-9-16-6-4-3-5-7-16/h3-7,12-13,15H,8-11H2,1-2H3/b17-13-.
What are the key properties of [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate?
[(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate has a molecular weight of 270.37 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate is sourced from PubChem (CID 70226149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).