C18H22O2 — CID 70226149
[(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate (PubChem CID 70226149) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate.
| Compound Name | [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 70226149 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [(Z)-(2,4-dimethylcyclohex-3-en-1-ylidene)methyl] 3-phenylpropanoate |
| SMILES | CC1=CC(C)/C(=C\OC(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H22O2/c1-14-8-10-17(15(2)12-14)13-20-18(19)11-9-16-6-4-3-5-7-16/h3-7,12-13,15H,8-11H2,1-2H3/b17-13- |
| InChIKey | FUEPXJJINAEGML-LGMDPLHJSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|