C13H26N+ — CID 11891418
trimethyl-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium (PubChem CID 11891418) has the molecular formula C13H26N+ and a molecular weight of 196.36 g/mol. Its IUPAC name is trimethyl-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium.
| Compound Name | trimethyl-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 11891418 |
| Molecular Formula | C13H26N+ |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.21 |
| IUPAC Name | trimethyl-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium |
| SMILES | CC1=C[C@@H](C)[C@H](C[N+](C)(C)C)[C@H](C)C1 |
| InChI | InChI=1S/C13H26N/c1-10-7-11(2)13(12(3)8-10)9-14(4,5)6/h7,11-13H,8-9H2,1-6H3/q+1/t11-,12-,13+/m1/s1 |
| InChIKey | BMJOTGJLAJOLGB-UPJWGTAASA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|