cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid

C10H13O9P — CID 19920931

IUPACcyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid
SMILESO=CC1C(C=O)C(C=O)C(C=O)C1C=O.O=P(O)(O)O
InChIInChI=1S/C10H10O5.H3O4P/c11-1-6-7(2-12)9(4-14)10(5-15)8(6)3-13;1-5(2,3)4/h1-10H;(H3,1,2,3,4)
InChIKeyQUDBDGNGANPEOO-UHFFFAOYSA-N
MW308.18 g/mol
LogP-1.85
Rot. Bonds5

About cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid

cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid (PubChem CID 19920931) has the molecular formula C10H13O9P and a molecular weight of 308.18 g/mol. Its IUPAC name is cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid.

Molecular Properties

Compound Namecyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid
PubChem CID19920931
Molecular FormulaC10H13O9P
Molecular Weight308.18 g/mol
Exact Mass308.03
IUPAC Namecyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid
SMILESO=CC1C(C=O)C(C=O)C(C=O)C1C=O.O=P(O)(O)O
InChIInChI=1S/C10H10O5.H3O4P/c11-1-6-7(2-12)9(4-14)10(5-15)8(6)3-13;1-5(2,3)4/h1-10H;(H3,1,2,3,4)
InChIKeyQUDBDGNGANPEOO-UHFFFAOYSA-N
XLogP-1.85
TPSA163.11 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.18
LogP ≤ 5-1.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid?
The IUPAC name of cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid (CID 19920931) is cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid.
What is the SMILES notation for cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid?
The canonical SMILES for cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid is O=CC1C(C=O)C(C=O)C(C=O)C1C=O.O=P(O)(O)O.
What is the InChIKey of cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid?
The InChIKey is QUDBDGNGANPEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5.H3O4P/c11-1-6-7(2-12)9(4-14)10(5-15)8(6)3-13;1-5(2,3)4/h1-10H;(H3,1,2,3,4).
What are the key properties of cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid?
cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid has a molecular weight of 308.18 g/mol, XLogP of -1.85, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane-1,2,3,4,5-pentacarbaldehyde;phosphoric acid is sourced from PubChem (CID 19920931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).