methane;phosphoric acid

CH10O8P2 — CID 18515646

IUPACmethane;phosphoric acid
SMILESC.O=P(O)(O)O.O=P(O)(O)O
InChIInChI=1S/CH4.2H3O4P/c;2*1-5(2,3)4/h1H4;2*(H3,1,2,3,4)
InChIKeyMWLAYKUVPMQBOW-UHFFFAOYSA-N
MW212.03 g/mol
LogP-1.22
Rot. Bonds

About methane;phosphoric acid

methane;phosphoric acid (PubChem CID 18515646) has the molecular formula CH10O8P2 and a molecular weight of 212.03 g/mol. Its IUPAC name is methane;phosphoric acid.

Molecular Properties

Compound Namemethane;phosphoric acid
PubChem CID18515646
Molecular FormulaCH10O8P2
Molecular Weight212.03 g/mol
Exact Mass211.99
IUPAC Namemethane;phosphoric acid
SMILESC.O=P(O)(O)O.O=P(O)(O)O
InChIInChI=1S/CH4.2H3O4P/c;2*1-5(2,3)4/h1H4;2*(H3,1,2,3,4)
InChIKeyMWLAYKUVPMQBOW-UHFFFAOYSA-N
XLogP-1.22
TPSA155.52 Ų
H-Bond Donors6
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500212.03
LogP ≤ 5-1.22
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze methane;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methane;phosphoric acid
CID 173400304
azane;methane;phosphoric acid
CID 174060347
magnesium;hydride;methane;phosphoric acid
CID 173272827
dipotassium;hydride;methane;phosphoric acid
CID 173423611
cobalt;methane;nickel;phosphoric acid
CID 175031347
tetralithium;phosphoric acid
CID 175822939
alumane;phosphoric acid
CID 173069752
phosphane;phosphoric acid
CID 172840180
phosphoric acid;hydrate
CID 22023151
phosphane;phosphoric acid
CID 173160232
iron;phosphoric acid
CID 174838016
cerium;phosphoric acid
CID 90659592

Frequently Asked Questions

What is the IUPAC name of methane;phosphoric acid?
The IUPAC name of methane;phosphoric acid (CID 18515646) is methane;phosphoric acid.
What is the SMILES notation for methane;phosphoric acid?
The canonical SMILES for methane;phosphoric acid is C.O=P(O)(O)O.O=P(O)(O)O.
What is the InChIKey of methane;phosphoric acid?
The InChIKey is MWLAYKUVPMQBOW-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4.2H3O4P/c;2*1-5(2,3)4/h1H4;2*(H3,1,2,3,4).
What are the key properties of methane;phosphoric acid?
methane;phosphoric acid has a molecular weight of 212.03 g/mol, XLogP of -1.22, 0 rotatable bonds, 6 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;phosphoric acid is sourced from PubChem (CID 18515646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).