About alumane;phosphoric acid
alumane;phosphoric acid (PubChem CID 173069752) has the molecular formula H9AlO8P2
and a molecular weight of 225.99 g/mol. Its IUPAC name is alumane;phosphoric acid.
Molecular Properties
| Compound Name | alumane;phosphoric acid |
| PubChem CID | 173069752 |
| Molecular Formula | H9AlO8P2 |
| Molecular Weight | 225.99 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | alumane;phosphoric acid |
| SMILES | O=P(O)(O)O.O=P(O)(O)O.[AlH3] |
| InChI | InChI=1S/Al.2H3O4P.3H/c;2*1-5(2,3)4;;;/h;2*(H3,1,2,3,4);;; |
| InChIKey | HXYJQUHWTJENNR-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 225.99 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alumane;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;phosphoric acid?
The IUPAC name of alumane;phosphoric acid (CID 173069752) is alumane;phosphoric acid.
What is the SMILES notation for alumane;phosphoric acid?
The canonical SMILES for alumane;phosphoric acid is O=P(O)(O)O.O=P(O)(O)O.[AlH3].
What is the InChIKey of alumane;phosphoric acid?
The InChIKey is HXYJQUHWTJENNR-UHFFFAOYSA-N. The full InChI is InChI=1S/Al.2H3O4P.3H/c;2*1-5(2,3)4;;;/h;2*(H3,1,2,3,4);;;.
What are the key properties of alumane;phosphoric acid?
alumane;phosphoric acid has a molecular weight of 225.99 g/mol, XLogP of -3.04, 0 rotatable bonds, 6 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;phosphoric acid is sourced from PubChem (CID 173069752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).