About phosphoric acid;titanium
phosphoric acid;titanium (PubChem CID 173034953) has the molecular formula H6O8P2Ti
and a molecular weight of 243.86 g/mol. Its IUPAC name is phosphoric acid;titanium.
Molecular Properties
| Compound Name | phosphoric acid;titanium |
| PubChem CID | 173034953 |
| Molecular Formula | H6O8P2Ti |
| Molecular Weight | 243.86 g/mol |
| Exact Mass | 243.90 |
| IUPAC Name | phosphoric acid;titanium |
| SMILES | O=P(O)(O)O.O=P(O)(O)O.[Ti] |
| InChI | InChI=1S/2H3O4P.Ti/c2*1-5(2,3)4;/h2*(H3,1,2,3,4); |
| InChIKey | AULHCKJRRDUTSQ-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 243.86 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphoric acid;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphoric acid;titanium?
The IUPAC name of phosphoric acid;titanium (CID 173034953) is phosphoric acid;titanium.
What is the SMILES notation for phosphoric acid;titanium?
The canonical SMILES for phosphoric acid;titanium is O=P(O)(O)O.O=P(O)(O)O.[Ti].
What is the InChIKey of phosphoric acid;titanium?
The InChIKey is AULHCKJRRDUTSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2H3O4P.Ti/c2*1-5(2,3)4;/h2*(H3,1,2,3,4);.
What are the key properties of phosphoric acid;titanium?
phosphoric acid;titanium has a molecular weight of 243.86 g/mol, XLogP of -1.86, 0 rotatable bonds, 6 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phosphoric acid;titanium is sourced from PubChem (CID 173034953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).