C18H13F21 — CID 130218430
1-ethenyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-4-methylcyclopentane (PubChem CID 130218430) has the molecular formula C18H13F21 and a molecular weight of 628.26 g/mol. Its IUPAC name is 1-ethenyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-4-methylcyclopentane.
| Compound Name | 1-ethenyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-4-methylcyclopentane |
|---|---|
| PubChem CID | 130218430 |
| Molecular Formula | C18H13F21 |
| Molecular Weight | 628.26 g/mol |
| Exact Mass | 628.07 |
| IUPAC Name | 1-ethenyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-4-methylcyclopentane |
| SMILES | C=CC1CC(C)CC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H13F21/c1-3-7-4-6(2)5-8(7)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)15(31,32)16(33,34)17(35,36)18(37,38)39/h3,6-8H,1,4-5H2,2H3 |
| InChIKey | QYKUAGQNISGDMA-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.26 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|