C17H29F5 — CID 20579548
15,15,16,16,16-pentafluoro-9-methylhexadec-1-ene (PubChem CID 20579548) has the molecular formula C17H29F5 and a molecular weight of 328.41 g/mol. Its IUPAC name is 15,15,16,16,16-pentafluoro-9-methylhexadec-1-ene.
| Compound Name | 15,15,16,16,16-pentafluoro-9-methylhexadec-1-ene |
|---|---|
| PubChem CID | 20579548 |
| Molecular Formula | C17H29F5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 15,15,16,16,16-pentafluoro-9-methylhexadec-1-ene |
| SMILES | C=CCCCCCCC(C)CCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H29F5/c1-3-4-5-6-7-9-12-15(2)13-10-8-11-14-16(18,19)17(20,21)22/h3,15H,1,4-14H2,2H3 |
| InChIKey | LWIWCWXDDFBLKH-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|