C19H36F2 — CID 10266938
(Z)-9,9-difluoro-2-methyloctadec-7-ene (PubChem CID 10266938) has the molecular formula C19H36F2 and a molecular weight of 302.49 g/mol. Its IUPAC name is (Z)-9,9-difluoro-2-methyloctadec-7-ene.
| Compound Name | (Z)-9,9-difluoro-2-methyloctadec-7-ene |
|---|---|
| PubChem CID | 10266938 |
| Molecular Formula | C19H36F2 |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.28 |
| IUPAC Name | (Z)-9,9-difluoro-2-methyloctadec-7-ene |
| SMILES | CCCCCCCCCC(F)(F)/C=C\CCCCC(C)C |
| InChI | InChI=1S/C19H36F2/c1-4-5-6-7-8-10-13-16-19(20,21)17-14-11-9-12-15-18(2)3/h14,17-18H,4-13,15-16H2,1-3H3/b17-14- |
| InChIKey | VBESZYZGADILNN-VKAVYKQESA-N |
| XLogP | 7.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|