C16H27F5 — CID 20579546
14,14,15,15,15-pentafluoro-9-methylpentadec-1-ene (PubChem CID 20579546) has the molecular formula C16H27F5 and a molecular weight of 314.38 g/mol. Its IUPAC name is 14,14,15,15,15-pentafluoro-9-methylpentadec-1-ene.
| Compound Name | 14,14,15,15,15-pentafluoro-9-methylpentadec-1-ene |
|---|---|
| PubChem CID | 20579546 |
| Molecular Formula | C16H27F5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 14,14,15,15,15-pentafluoro-9-methylpentadec-1-ene |
| SMILES | C=CCCCCCCC(C)CCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H27F5/c1-3-4-5-6-7-8-11-14(2)12-9-10-13-15(17,18)16(19,20)21/h3,14H,1,4-13H2,2H3 |
| InChIKey | WLZUMADUCVNXHZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|