C19H8F26 — CID 14024093
5,6-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 14024093) has the molecular formula C19H8F26 and a molecular weight of 730.22 g/mol. Its IUPAC name is 5,6-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,6-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 14024093 |
| Molecular Formula | C19H8F26 |
| Molecular Weight | 730.22 g/mol |
| Exact Mass | 730.02 |
| IUPAC Name | 5,6-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1C2C=CC(C2)C1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H8F26/c20-8(21,10(24,25)12(28,29)14(32,33)16(36,37)18(40,41)42)6-4-1-2-5(3-4)7(6)9(22,23)11(26,27)13(30,31)15(34,35)17(38,39)19(43,44)45/h1-2,4-7H,3H2 |
| InChIKey | IRODAZMVKXCVQF-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.22 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|