C10H10F2 — CID 558560
5,10-difluorotricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 558560) has the molecular formula C10H10F2 and a molecular weight of 168.19 g/mol. Its IUPAC name is 5,10-difluorotricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | 5,10-difluorotricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 558560 |
| Molecular Formula | C10H10F2 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 5,10-difluorotricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | FC1C=CC2C3C=CC(C3F)C12 |
| InChI | InChI=1S/C10H10F2/c11-8-4-3-5-6-1-2-7(9(5)8)10(6)12/h1-10H |
| InChIKey | SFSPXCAHHFMVQW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|