C10H12 — CID 10176158
(1R,2S,6R,7S)-tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 10176158) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 10176158 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=C[C@@H]2[C@H](C1)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C10H12/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,4-5,7-10H,3,6H2/t7-,8+,9-,10+/m0/s1 |
| InChIKey | HECLRDQVFMWTQS-QCLAVDOMSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|