About 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane
7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane (PubChem CID 123453838) has the molecular formula C18H30
and a molecular weight of 246.44 g/mol. Its IUPAC name is 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane.
Analyze 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane?
The IUPAC name of 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane (CID 123453838) is 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane.
What is the SMILES notation for 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane?
The canonical SMILES for 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane is CC1CC(C)CC2C(C1)CC1C(C)C3CC3CC21.
What is the InChIKey of 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane?
The InChIKey is BGVOJZHIVJNHOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30/c1-10-4-11(2)6-17-13(5-10)8-16-12(3)15-7-14(15)9-18(16)17/h10-18H,4-9H2,1-3H3.
What are the key properties of 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane?
7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane has a molecular weight of 246.44 g/mol, XLogP of 4.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7,12,14-trimethyltetracyclo[8.5.0.02,8.04,6]pentadecane is sourced from PubChem (CID 123453838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).