C12H22 — CID 91357459
(3aR,7aS)-2,4,5-trimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 91357459) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (3aR,7aS)-2,4,5-trimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | (3aR,7aS)-2,4,5-trimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 91357459 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (3aR,7aS)-2,4,5-trimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC1C[C@@H]2CCC(C)C(C)[C@@H]2C1 |
| InChI | InChI=1S/C12H22/c1-8-6-11-5-4-9(2)10(3)12(11)7-8/h8-12H,4-7H2,1-3H3/t8?,9?,10?,11-,12-/m0/s1 |
| InChIKey | UMSUYGZKXFPKLC-ZTNMXLFQSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |