C18H32 — CID 123566635
1,2,7,8-tetramethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 123566635) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is 1,2,7,8-tetramethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | 1,2,7,8-tetramethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 123566635 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 1,2,7,8-tetramethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | CC1CCC2C(CCC3C(C)C(C)CCC32)C1C |
| InChI | InChI=1S/C18H32/c1-11-5-7-17-15(13(11)3)9-10-16-14(4)12(2)6-8-18(16)17/h11-18H,5-10H2,1-4H3 |
| InChIKey | NTGHIVSAIAMKPP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |