C7H12 — CID 154518403
(1S,2S)-2-methylbicyclo[3.1.0]hexane (PubChem CID 154518403) has the molecular formula C7H12 and a molecular weight of 96.17 g/mol. Its IUPAC name is (1S,2S)-2-methylbicyclo[3.1.0]hexane.
| Compound Name | (1S,2S)-2-methylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 154518403 |
| Molecular Formula | C7H12 |
| Molecular Weight | 96.17 g/mol |
| Exact Mass | 96.09 |
| IUPAC Name | (1S,2S)-2-methylbicyclo[3.1.0]hexane |
| SMILES | C[C@H]1CCC2C[C@H]21 |
| InChI | InChI=1S/C7H12/c1-5-2-3-6-4-7(5)6/h5-7H,2-4H2,1H3/t5-,6?,7-/m0/s1 |
| InChIKey | QRDJCCQTEQVLKC-LOJRBXKRSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |