About cis-(1R,3S)-cyclohexane-1,3-diol
cis-(1R,3S)-cyclohexane-1,3-diol (PubChem CID 6432741) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is cis-(1R,3S)-cyclohexane-1,3-diol.
Molecular Properties
| Compound Name | cis-(1R,3S)-cyclohexane-1,3-diol |
| PubChem CID | 6432741 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | cis-(1R,3S)-cyclohexane-1,3-diol |
| SMILES | O[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C6H12O2/c7-5-2-1-3-6(8)4-5/h5-8H,1-4H2/t5-,6+ |
| InChIKey | RLMGYIOTPQVQJR-OLQVQODUSA-N |
| XLogP | 0.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1R,3S)-cyclohexane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-cyclohexane-1,3-diol?
The IUPAC name of cis-(1R,3S)-cyclohexane-1,3-diol (CID 6432741) is cis-(1R,3S)-cyclohexane-1,3-diol.
What is the SMILES notation for cis-(1R,3S)-cyclohexane-1,3-diol?
The canonical SMILES for cis-(1R,3S)-cyclohexane-1,3-diol is O[C@@H]1CCC[C@H](O)C1.
What is the InChIKey of cis-(1R,3S)-cyclohexane-1,3-diol?
The InChIKey is RLMGYIOTPQVQJR-OLQVQODUSA-N. The full InChI is InChI=1S/C6H12O2/c7-5-2-1-3-6(8)4-5/h5-8H,1-4H2/t5-,6+.
What are the key properties of cis-(1R,3S)-cyclohexane-1,3-diol?
cis-(1R,3S)-cyclohexane-1,3-diol has a molecular weight of 116.16 g/mol, XLogP of 0.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-cyclohexane-1,3-diol is sourced from PubChem (CID 6432741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).