C6H12KO2+ — CID 22067166
potassium cyclohexane-1,3-diol (PubChem CID 22067166) has the molecular formula C6H12KO2+ and a molecular weight of 155.26 g/mol. Its IUPAC name is potassium cyclohexane-1,3-diol.
| Compound Name | potassium cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 22067166 |
| Molecular Formula | C6H12KO2+ |
| Molecular Weight | 155.26 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | potassium cyclohexane-1,3-diol |
| SMILES | OC1CCCC(O)C1.[K+] |
| InChI | InChI=1S/C6H12O2.K/c7-5-2-1-3-6(8)4-5;/h5-8H,1-4H2;/q;+1 |
| InChIKey | QLVOTYQALKBRCN-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.26 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |