C8H16O2 — CID 59075450
cis-(1S,3R)-cyclooctane-1,3-diol (PubChem CID 59075450) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is cis-(1S,3R)-cyclooctane-1,3-diol.
| Compound Name | cis-(1S,3R)-cyclooctane-1,3-diol |
|---|---|
| PubChem CID | 59075450 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | cis-(1S,3R)-cyclooctane-1,3-diol |
| SMILES | O[C@@H]1CCCCC[C@H](O)C1 |
| InChI | InChI=1S/C8H16O2/c9-7-4-2-1-3-5-8(10)6-7/h7-10H,1-6H2/t7-,8+ |
| InChIKey | DNJRSNYMHOVSGB-OCAPTIKFSA-N |
| XLogP | 1.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |