C10H20O3 — CID 71423393
acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol (PubChem CID 71423393) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol.
| Compound Name | acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol |
|---|---|
| PubChem CID | 71423393 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol |
| SMILES | CC(=O)O.C[C@H]1CCCC[C@H](O)C1 |
| InChI | InChI=1S/C8H16O.C2H4O2/c1-7-4-2-3-5-8(9)6-7;1-2(3)4/h7-9H,2-6H2,1H3;1H3,(H,3,4)/t7-,8-;/m0./s1 |
| InChIKey | TVFLSRLPVPAOTH-WSZWBAFRSA-N |
| XLogP | 2.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |