acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol

C10H20O3 — CID 71423393

IUPACacetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol
SMILESCC(=O)O.C[C@H]1CCCC[C@H](O)C1
InChIInChI=1S/C8H16O.C2H4O2/c1-7-4-2-3-5-8(9)6-7;1-2(3)4/h7-9H,2-6H2,1H3;1H3,(H,3,4)/t7-,8-;/m0./s1
InChIKeyTVFLSRLPVPAOTH-WSZWBAFRSA-N
MW188.27 g/mol
LogP2.04
Rot. Bonds

About acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol

acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol (PubChem CID 71423393) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol.

Molecular Properties

Compound Nameacetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol
PubChem CID71423393
Molecular FormulaC10H20O3
Molecular Weight188.27 g/mol
Exact Mass188.14
IUPAC Nameacetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol
SMILESCC(=O)O.C[C@H]1CCCC[C@H](O)C1
InChIInChI=1S/C8H16O.C2H4O2/c1-7-4-2-3-5-8(9)6-7;1-2(3)4/h7-9H,2-6H2,1H3;1H3,(H,3,4)/t7-,8-;/m0./s1
InChIKeyTVFLSRLPVPAOTH-WSZWBAFRSA-N
XLogP2.04
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.27
LogP ≤ 52.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol?
The IUPAC name of acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol (CID 71423393) is acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol.
What is the SMILES notation for acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol?
The canonical SMILES for acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol is CC(=O)O.C[C@H]1CCCC[C@H](O)C1.
What is the InChIKey of acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol?
The InChIKey is TVFLSRLPVPAOTH-WSZWBAFRSA-N. The full InChI is InChI=1S/C8H16O.C2H4O2/c1-7-4-2-3-5-8(9)6-7;1-2(3)4/h7-9H,2-6H2,1H3;1H3,(H,3,4)/t7-,8-;/m0./s1.
What are the key properties of acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol?
acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol has a molecular weight of 188.27 g/mol, XLogP of 2.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;trans-(1S,3S)-3-methylcycloheptan-1-ol is sourced from PubChem (CID 71423393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).