C8H11ClO5 — CID 70591535
2-[(1S,2R,4S)-2-chloro-4-hydroxycyclopentyl]propanedioic acid (PubChem CID 70591535) has the molecular formula C8H11ClO5 and a molecular weight of 222.62 g/mol. Its IUPAC name is 2-[(1S,2R,4S)-2-chloro-4-hydroxycyclopentyl]propanedioic acid.
| Compound Name | 2-[(1S,2R,4S)-2-chloro-4-hydroxycyclopentyl]propanedioic acid |
|---|---|
| PubChem CID | 70591535 |
| Molecular Formula | C8H11ClO5 |
| Molecular Weight | 222.62 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2-[(1S,2R,4S)-2-chloro-4-hydroxycyclopentyl]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)[C@@H]1C[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C8H11ClO5/c9-5-2-3(10)1-4(5)6(7(11)12)8(13)14/h3-6,10H,1-2H2,(H,11,12)(H,13,14)/t3-,4+,5+/m0/s1 |
| InChIKey | PSURVYZRMAZVIN-VPENINKCSA-N |
| XLogP | 0.15 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.62 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|