C7H11F3O2 — CID 99986355
cis-(1S,3R)-5-(trifluoromethyl)cyclohexane-1,3-diol (PubChem CID 99986355) has the molecular formula C7H11F3O2 and a molecular weight of 184.16 g/mol. Its IUPAC name is cis-(1S,3R)-5-(trifluoromethyl)cyclohexane-1,3-diol.
| Compound Name | cis-(1S,3R)-5-(trifluoromethyl)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 99986355 |
| Molecular Formula | C7H11F3O2 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | cis-(1S,3R)-5-(trifluoromethyl)cyclohexane-1,3-diol |
| SMILES | O[C@@H]1CC(C(F)(F)F)C[C@H](O)C1 |
| InChI | InChI=1S/C7H11F3O2/c8-7(9,10)4-1-5(11)3-6(12)2-4/h4-6,11-12H,1-3H2/t4?,5-,6+ |
| InChIKey | DXOUYJLBIRRNDH-GOHHTPAQSA-N |
| XLogP | 1.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |