C8H11F6N — CID 27808394
cis-(3R,5S)-3,5-bis(trifluoromethyl)cyclohexan-1-amine (PubChem CID 27808394) has the molecular formula C8H11F6N and a molecular weight of 235.17 g/mol. Its IUPAC name is cis-(3R,5S)-3,5-bis(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | cis-(3R,5S)-3,5-bis(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 27808394 |
| Molecular Formula | C8H11F6N |
| Molecular Weight | 235.17 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | cis-(3R,5S)-3,5-bis(trifluoromethyl)cyclohexan-1-amine |
| SMILES | NC1C[C@@H](C(F)(F)F)C[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C8H11F6N/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h4-6H,1-3,15H2/t4-,5+,6? |
| InChIKey | HLLGJXAKKIPKMP-XEAPYIEGSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |