C8H14F3N — CID 97297725
trans-(1R,3R)-3-(trifluoromethyl)cycloheptan-1-amine (PubChem CID 97297725) has the molecular formula C8H14F3N and a molecular weight of 181.20 g/mol. Its IUPAC name is trans-(1R,3R)-3-(trifluoromethyl)cycloheptan-1-amine.
| Compound Name | trans-(1R,3R)-3-(trifluoromethyl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 97297725 |
| Molecular Formula | C8H14F3N |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | trans-(1R,3R)-3-(trifluoromethyl)cycloheptan-1-amine |
| SMILES | N[C@@H]1CCCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C8H14F3N/c9-8(10,11)6-3-1-2-4-7(12)5-6/h6-7H,1-5,12H2/t6-,7-/m1/s1 |
| InChIKey | SUPFCUKHIQGRJV-RNFRBKRXSA-N |
| XLogP | 2.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |