C7H13F3N2 — CID 124506889
[(1R,3S)-3-(trifluoromethyl)cyclohexyl]hydrazine (PubChem CID 124506889) has the molecular formula C7H13F3N2 and a molecular weight of 182.19 g/mol. Its IUPAC name is [(1R,3S)-3-(trifluoromethyl)cyclohexyl]hydrazine.
| Compound Name | [(1R,3S)-3-(trifluoromethyl)cyclohexyl]hydrazine |
|---|---|
| PubChem CID | 124506889 |
| Molecular Formula | C7H13F3N2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | [(1R,3S)-3-(trifluoromethyl)cyclohexyl]hydrazine |
| SMILES | NN[C@@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C7H13F3N2/c8-7(9,10)5-2-1-3-6(4-5)12-11/h5-6,12H,1-4,11H2/t5-,6+/m0/s1 |
| InChIKey | ZADCDXGGSDKHKY-NTSWFWBYSA-N |
| XLogP | 1.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|