C10H14F6O — CID 172565004
2-[3,5-bis(trifluoromethyl)cyclohexyl]ethanol (PubChem CID 172565004) has the molecular formula C10H14F6O and a molecular weight of 264.21 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)cyclohexyl]ethanol.
| Compound Name | 2-[3,5-bis(trifluoromethyl)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 172565004 |
| Molecular Formula | C10H14F6O |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)cyclohexyl]ethanol |
| SMILES | OCCC1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F6O/c11-9(12,13)7-3-6(1-2-17)4-8(5-7)10(14,15)16/h6-8,17H,1-5H2 |
| InChIKey | NYDNVVMGWRRUHO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |