C7H13NO3 — CID 117046519
3,5-dihydroxycyclohexane-1-carboxamide (PubChem CID 117046519) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 3,5-dihydroxycyclohexane-1-carboxamide.
| Compound Name | 3,5-dihydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 117046519 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 3,5-dihydroxycyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CC(O)CC(O)C1 |
| InChI | InChI=1S/C7H13NO3/c8-7(11)4-1-5(9)3-6(10)2-4/h4-6,9-10H,1-3H2,(H2,8,11) |
| InChIKey | HNXVYCCIWSKLIP-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |