C5H10N2O2 — CID 146018173
N',3-dihydroxycyclobutane-1-carboximidamide (PubChem CID 146018173) has the molecular formula C5H10N2O2 and a molecular weight of 130.15 g/mol. Its IUPAC name is N',3-dihydroxycyclobutane-1-carboximidamide.
| Compound Name | N',3-dihydroxycyclobutane-1-carboximidamide |
|---|---|
| PubChem CID | 146018173 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | N',3-dihydroxycyclobutane-1-carboximidamide |
| SMILES | N/C(=N\O)C1CC(O)C1 |
| InChI | InChI=1S/C5H10N2O2/c6-5(7-9)3-1-4(8)2-3/h3-4,8-9H,1-2H2,(H2,6,7) |
| InChIKey | MCIXRLPWBPKHTK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|