C8H14N2O — CID 167308554
(3S,5R)-1-ethyl-5-hydroxypiperidine-3-carbonitrile (PubChem CID 167308554) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (3S,5R)-1-ethyl-5-hydroxypiperidine-3-carbonitrile.
| Compound Name | (3S,5R)-1-ethyl-5-hydroxypiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 167308554 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (3S,5R)-1-ethyl-5-hydroxypiperidine-3-carbonitrile |
| SMILES | CCN1C[C@H](O)C[C@H](C#N)C1 |
| InChI | InChI=1S/C8H14N2O/c1-2-10-5-7(4-9)3-8(11)6-10/h7-8,11H,2-3,5-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | KENNGYHSXKIUTB-HTQZYQBOSA-N |
| XLogP | 0.21 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |