C10H19NO — CID 130987265
2-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 130987265) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 130987265 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 2-ethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CCN1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C10H19NO/c1-2-11-6-8-3-4-10(12)5-9(8)7-11/h8-10,12H,2-7H2,1H3 |
| InChIKey | QEGHTFWWWHMZRU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |