C10H18BrNO — CID 131000722
2-(2-bromoethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 131000722) has the molecular formula C10H18BrNO and a molecular weight of 248.16 g/mol. Its IUPAC name is 2-(2-bromoethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-(2-bromoethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 131000722 |
| Molecular Formula | C10H18BrNO |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-(2-bromoethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | OC1CCC2CN(CCBr)CC2C1 |
| InChI | InChI=1S/C10H18BrNO/c11-3-4-12-6-8-1-2-10(13)5-9(8)7-12/h8-10,13H,1-7H2 |
| InChIKey | IJXKRFPIBZKDMY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|