C9H17N3O2 — CID 130804469
5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbohydrazide (PubChem CID 130804469) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbohydrazide.
| Compound Name | 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbohydrazide |
|---|---|
| PubChem CID | 130804469 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbohydrazide |
| SMILES | NNC(=O)N1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C9H17N3O2/c10-11-9(14)12-4-6-1-2-8(13)3-7(6)5-12/h6-8,13H,1-5,10H2,(H,11,14) |
| InChIKey | IAZMRHKGFIPMDZ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|