C14H18F3N3O2S — CID 136548965
5-hydroxy-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 136548965) has the molecular formula C14H18F3N3O2S and a molecular weight of 349.38 g/mol. Its IUPAC name is 5-hydroxy-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | 5-hydroxy-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 136548965 |
| Molecular Formula | C14H18F3N3O2S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5-hydroxy-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | O=C(NC(c1nccs1)C(F)(F)F)N1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C14H18F3N3O2S/c15-14(16,17)11(12-18-3-4-23-12)19-13(22)20-6-8-1-2-10(21)5-9(8)7-20/h3-4,8-11,21H,1-2,5-7H2,(H,19,22) |
| InChIKey | CRSSUKLTEGUQMC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |