C15H19F3N2O2S — CID 136586610
[(3aR,5R,7aS)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(3,3,3-trifluoropropyl)-1,3-thiazol-5-yl]methanone (PubChem CID 136586610) has the molecular formula C15H19F3N2O2S and a molecular weight of 348.39 g/mol. Its IUPAC name is [(3aR,5R,7aS)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(3,3,3-trifluoropropyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | [(3aR,5R,7aS)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(3,3,3-trifluoropropyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 136586610 |
| Molecular Formula | C15H19F3N2O2S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [(3aR,5R,7aS)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(3,3,3-trifluoropropyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(CCC(F)(F)F)s1)N1C[C@H]2CC[C@@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C15H19F3N2O2S/c16-15(17,18)4-3-13-19-6-12(23-13)14(22)20-7-9-1-2-11(21)5-10(9)8-20/h6,9-11,21H,1-5,7-8H2/t9-,10+,11-/m1/s1 |
| InChIKey | NXAQKPLANFNTIF-OUAUKWLOSA-N |
| XLogP | 2.87 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |