C18H21N3O2S — CID 136586611
[(3aS,5S,7aR)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(2-methylphenyl)thiadiazol-5-yl]methanone (PubChem CID 136586611) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is [(3aS,5S,7aR)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(2-methylphenyl)thiadiazol-5-yl]methanone.
| Compound Name | [(3aS,5S,7aR)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(2-methylphenyl)thiadiazol-5-yl]methanone |
|---|---|
| PubChem CID | 136586611 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(3aS,5S,7aR)-5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[4-(2-methylphenyl)thiadiazol-5-yl]methanone |
| SMILES | Cc1ccccc1-c1nnsc1C(=O)N1C[C@H]2C[C@@H](O)CC[C@H]2C1 |
| InChI | InChI=1S/C18H21N3O2S/c1-11-4-2-3-5-15(11)16-17(24-20-19-16)18(23)21-9-12-6-7-14(22)8-13(12)10-21/h2-5,12-14,22H,6-10H2,1H3/t12-,13+,14-/m0/s1 |
| InChIKey | JWCFZYDYSRIUDO-MJBXVCDLSA-N |
| XLogP | 2.75 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |