C12H18N4OS — CID 43596072
[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 43596072) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 43596072 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1C[C@H]2CCC(N)C[C@H]2C1 |
| InChI | InChI=1S/C12H18N4OS/c1-7-11(18-15-14-7)12(17)16-5-8-2-3-10(13)4-9(8)6-16/h8-10H,2-6,13H2,1H3/t8-,9+,10?/m1/s1 |
| InChIKey | RDBVFSLHZZHOPC-ZDGBYWQASA-N |
| XLogP | 1.05 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |