C11H13N3O5S — CID 115918213
1-(4-methylthiadiazole-5-carbonyl)piperidine-3,4-dicarboxylic acid (PubChem CID 115918213) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-(4-methylthiadiazole-5-carbonyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(4-methylthiadiazole-5-carbonyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115918213 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-(4-methylthiadiazole-5-carbonyl)piperidine-3,4-dicarboxylic acid |
| SMILES | Cc1nnsc1C(=O)N1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C11H13N3O5S/c1-5-8(20-13-12-5)9(15)14-3-2-6(10(16)17)7(4-14)11(18)19/h6-7H,2-4H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | CMPXFTMXDWZTRO-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |