C7H10N4OS — CID 65244992
(3-aminoazetidin-1-yl)-(4-methylthiadiazol-5-yl)methanone (PubChem CID 65244992) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is (3-aminoazetidin-1-yl)-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | (3-aminoazetidin-1-yl)-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 65244992 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (3-aminoazetidin-1-yl)-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CC(N)C1 |
| InChI | InChI=1S/C7H10N4OS/c1-4-6(13-10-9-4)7(12)11-2-5(8)3-11/h5H,2-3,8H2,1H3 |
| InChIKey | QOXKCLNMTBBUDJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |