C22H25NO3 — CID 86286591
[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(3-methylphenyl)phenyl]methanone (PubChem CID 86286591) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(3-methylphenyl)phenyl]methanone.
| Compound Name | [(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(3-methylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 86286591 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(3-methylphenyl)phenyl]methanone |
| SMILES | Cc1cccc(-c2ccccc2C(=O)N2C[C@H]3C[C@H](O)[C@H](O)C[C@H]3C2)c1 |
| InChI | InChI=1S/C22H25NO3/c1-14-5-4-6-15(9-14)18-7-2-3-8-19(18)22(26)23-12-16-10-20(24)21(25)11-17(16)13-23/h2-9,16-17,20-21,24-25H,10-13H2,1H3/t16-,17+,20+,21- |
| InChIKey | NNKVZIKNTCQWMG-BTYSMDAFSA-N |
| XLogP | 2.87 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |