C24H30N2O2 — CID 135120241
[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-[2-(3-methylphenyl)phenyl]methanone (PubChem CID 135120241) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-[2-(3-methylphenyl)phenyl]methanone.
| Compound Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-[2-(3-methylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 135120241 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-[2-(3-methylphenyl)phenyl]methanone |
| SMILES | Cc1cccc(-c2ccccc2C(=O)N2CC[C@@]3(CO)CCCN(C)[C@@H]3C2)c1 |
| InChI | InChI=1S/C24H30N2O2/c1-18-7-5-8-19(15-18)20-9-3-4-10-21(20)23(28)26-14-12-24(17-27)11-6-13-25(2)22(24)16-26/h3-5,7-10,15,22,27H,6,11-14,16-17H2,1-2H3/t22-,24-/m1/s1 |
| InChIKey | MVFRCCACMLLOCE-ISKFKSNPSA-N |
| XLogP | 3.58 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |