C27H25N3OS — CID 67116715
[2-(6-methyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-phenylphenyl)methanone (PubChem CID 67116715) has the molecular formula C27H25N3OS and a molecular weight of 439.58 g/mol. Its IUPAC name is [2-(6-methyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-phenylphenyl)methanone.
| Compound Name | [2-(6-methyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-phenylphenyl)methanone |
|---|---|
| PubChem CID | 67116715 |
| Molecular Formula | C27H25N3OS |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [2-(6-methyl-1,3-benzothiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-phenylphenyl)methanone |
| SMILES | Cc1ccc2nc(N3CC4CN(C(=O)c5ccccc5-c5ccccc5)CC4C3)sc2c1 |
| InChI | InChI=1S/C27H25N3OS/c1-18-11-12-24-25(13-18)32-27(28-24)30-16-20-14-29(15-21(20)17-30)26(31)23-10-6-5-9-22(23)19-7-3-2-4-8-19/h2-13,20-21H,14-17H2,1H3 |
| InChIKey | XBXFTAANADBTHX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |