C7H6ClF3N2OS — CID 146107361
2-chloro-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 146107361) has the molecular formula C7H6ClF3N2OS and a molecular weight of 258.65 g/mol. Its IUPAC name is 2-chloro-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | 2-chloro-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 146107361 |
| Molecular Formula | C7H6ClF3N2OS |
| Molecular Weight | 258.65 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 2-chloro-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | O=C(CCl)NC(c1nccs1)C(F)(F)F |
| InChI | InChI=1S/C7H6ClF3N2OS/c8-3-4(14)13-5(7(9,10)11)6-12-1-2-15-6/h1-2,5H,3H2,(H,13,14) |
| InChIKey | QGJVESJEOUZPHE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.65 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|