C11H18N2OS — CID 96824330
4-[[(1S)-1-(1,3-thiazol-2-yl)ethyl]amino]cyclohexan-1-ol (PubChem CID 96824330) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 4-[[(1S)-1-(1,3-thiazol-2-yl)ethyl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[(1S)-1-(1,3-thiazol-2-yl)ethyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 96824330 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-[[(1S)-1-(1,3-thiazol-2-yl)ethyl]amino]cyclohexan-1-ol |
| SMILES | C[C@H](NC1CCC(O)CC1)c1nccs1 |
| InChI | InChI=1S/C11H18N2OS/c1-8(11-12-6-7-15-11)13-9-2-4-10(14)5-3-9/h6-10,13-14H,2-5H2,1H3/t8-,9?,10?/m0/s1 |
| InChIKey | RRXGKWBZRILWCZ-IDKOKCKLSA-N |
| XLogP | 2.10 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |