C11H19N3S — CID 79459169
1-N-[1-(1,3-thiazol-2-yl)ethyl]cyclohexane-1,3-diamine (PubChem CID 79459169) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 1-N-[1-(1,3-thiazol-2-yl)ethyl]cyclohexane-1,3-diamine.
| Compound Name | 1-N-[1-(1,3-thiazol-2-yl)ethyl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79459169 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-N-[1-(1,3-thiazol-2-yl)ethyl]cyclohexane-1,3-diamine |
| SMILES | CC(NC1CCCC(N)C1)c1nccs1 |
| InChI | InChI=1S/C11H19N3S/c1-8(11-13-5-6-15-11)14-10-4-2-3-9(12)7-10/h5-6,8-10,14H,2-4,7,12H2,1H3 |
| InChIKey | UOCGUTIMSZUAOM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |