C12H21N3S — CID 79459168
1-N-[1-(1,3-thiazol-2-yl)propyl]cyclohexane-1,3-diamine (PubChem CID 79459168) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 1-N-[1-(1,3-thiazol-2-yl)propyl]cyclohexane-1,3-diamine.
| Compound Name | 1-N-[1-(1,3-thiazol-2-yl)propyl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79459168 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-N-[1-(1,3-thiazol-2-yl)propyl]cyclohexane-1,3-diamine |
| SMILES | CCC(NC1CCCC(N)C1)c1nccs1 |
| InChI | InChI=1S/C12H21N3S/c1-2-11(12-14-6-7-16-12)15-10-5-3-4-9(13)8-10/h6-7,9-11,15H,2-5,8,13H2,1H3 |
| InChIKey | ZSQVGJXGSQNFSC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |