C14H23N3S — CID 102894599
N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-1-(1,3-thiazol-2-yl)propan-1-amine (PubChem CID 102894599) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-1-(1,3-thiazol-2-yl)propan-1-amine.
| Compound Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-1-(1,3-thiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 102894599 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-1-(1,3-thiazol-2-yl)propan-1-amine |
| SMILES | CCC(NCC1NCC2CCCC21)c1nccs1 |
| InChI | InChI=1S/C14H23N3S/c1-2-12(14-15-6-7-18-14)17-9-13-11-5-3-4-10(11)8-16-13/h6-7,10-13,16-17H,2-5,8-9H2,1H3 |
| InChIKey | FBWIXBJCGBSLJR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |