C11H19N3S — CID 79459271
1-N-[2-(1,3-thiazol-2-yl)ethyl]cyclohexane-1,3-diamine (PubChem CID 79459271) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 1-N-[2-(1,3-thiazol-2-yl)ethyl]cyclohexane-1,3-diamine.
| Compound Name | 1-N-[2-(1,3-thiazol-2-yl)ethyl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79459271 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-N-[2-(1,3-thiazol-2-yl)ethyl]cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(NCCc2nccs2)C1 |
| InChI | InChI=1S/C11H19N3S/c12-9-2-1-3-10(8-9)13-5-4-11-14-6-7-15-11/h6-7,9-10,13H,1-5,8,12H2 |
| InChIKey | MNWLDOWCVVUMAQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |