C11H16N2S — CID 130941268
N-[1-(1,3-thiazol-2-yl)ethyl]bicyclo[3.1.0]hexan-3-amine (PubChem CID 130941268) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)ethyl]bicyclo[3.1.0]hexan-3-amine.
| Compound Name | N-[1-(1,3-thiazol-2-yl)ethyl]bicyclo[3.1.0]hexan-3-amine |
|---|---|
| PubChem CID | 130941268 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)ethyl]bicyclo[3.1.0]hexan-3-amine |
| SMILES | CC(NC1CC2CC2C1)c1nccs1 |
| InChI | InChI=1S/C11H16N2S/c1-7(11-12-2-3-14-11)13-10-5-8-4-9(8)6-10/h2-3,7-10,13H,4-6H2,1H3 |
| InChIKey | IQOCPRKQZPEHOY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |